C30H44O10 — CID 122187831
[(1R,2S,3E,5R,7S,10R,11R,12R,13S,14S)-1,2,10,11-tetraacetyloxy-3,6,6,10,14-pentamethyl-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] acetate (PubChem CID 122187831) has the molecular formula C30H44O10 and a molecular weight of 564.67 g/mol. Its IUPAC name is [(1R,2S,3E,5R,7S,10R,11R,12R,13S,14S)-1,2,10,11-tetraacetyloxy-3,6,6,10,14-pentamethyl-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] acetate.
| Compound Name | [(1R,2S,3E,5R,7S,10R,11R,12R,13S,14S)-1,2,10,11-tetraacetyloxy-3,6,6,10,14-pentamethyl-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] acetate |
|---|---|
| PubChem CID | 122187831 |
| Molecular Formula | C30H44O10 |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [(1R,2S,3E,5R,7S,10R,11R,12R,13S,14S)-1,2,10,11-tetraacetyloxy-3,6,6,10,14-pentamethyl-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@H](OC(C)=O)[C@](C)(OC(C)=O)CC[C@H]3[C@@H](/C=C(\C)[C@H](OC(C)=O)[C@@]2(OC(C)=O)C[C@@H]1C)C3(C)C |
| InChI | InChI=1S/C30H44O10/c1-15-13-23-22(28(23,8)9)11-12-29(10,39-20(6)34)27(38-19(5)33)24-25(36-17(3)31)16(2)14-30(24,40-21(7)35)26(15)37-18(4)32/h13,16,22-27H,11-12,14H2,1-10H3/b15-13+/t16-,22-,23+,24+,25-,26-,27+,29+,30+/m0/s1 |
| InChIKey | KRBYMEDZQXIEBP-BMMGRBQQSA-N |
| XLogP | 4.07 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|