C28H27O7PS — CID 122188146
3-[hydroxy-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]phosphinothioyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one (PubChem CID 122188146) has the molecular formula C28H27O7PS and a molecular weight of 538.56 g/mol. Its IUPAC name is 3-[hydroxy-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]phosphinothioyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one.
| Compound Name | 3-[hydroxy-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]phosphinothioyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
|---|---|
| PubChem CID | 122188146 |
| Molecular Formula | C28H27O7PS |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 3-[hydroxy-[(6-oxo-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-3-yl)oxy]phosphinothioyl]oxy-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
| SMILES | O=c1oc2cc(OP(O)(=S)Oc3ccc4c5c(c(=O)oc4c3)CCCCC5)ccc2c2c1CCCCC2 |
| InChI | InChI=1S/C28H27O7PS/c29-27-23-9-5-1-3-7-19(23)21-13-11-17(15-25(21)32-27)34-36(31,37)35-18-12-14-22-20-8-4-2-6-10-24(20)28(30)33-26(22)16-18/h11-16H,1-10H2,(H,31,37) |
| InChIKey | ZNXWECZFTATTCE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|