About N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide
N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide (PubChem CID 122188238) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide |
| PubChem CID | 122188238 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1CCc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-15(22)20-13-18-12-11-17-9-5-6-10-19(17)21(18)14-16-7-3-2-4-8-16/h2-10,18H,11-14H2,1H3,(H,20,22)/t18-/m0/s1 |
| InChIKey | CGEJOVUHOJQGJO-SFHVURJKSA-N |
| XLogP | 3.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide?
The IUPAC name of N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide (CID 122188238) is N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide.
What is the SMILES notation for N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide?
The canonical SMILES for N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide is CC(=O)NC[C@@H]1CCc2ccccc2N1Cc1ccccc1.
What is the InChIKey of N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide?
The InChIKey is CGEJOVUHOJQGJO-SFHVURJKSA-N. The full InChI is InChI=1S/C19H22N2O/c1-15(22)20-13-18-12-11-17-9-5-6-10-19(17)21(18)14-16-7-3-2-4-8-16/h2-10,18H,11-14H2,1H3,(H,20,22)/t18-/m0/s1.
What are the key properties of N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide?
N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide has a molecular weight of 294.40 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-1-benzyl-3,4-dihydro-2H-quinolin-2-yl]methyl]acetamide is sourced from PubChem (CID 122188238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).