C15H14ClN5O4S — CID 122188279
N-[2-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)ethyl]-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 122188279) has the molecular formula C15H14ClN5O4S and a molecular weight of 395.83 g/mol. Its IUPAC name is N-[2-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)ethyl]-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[2-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)ethyl]-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122188279 |
| Molecular Formula | C15H14ClN5O4S |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-[2-(5-chloropyrazolo[1,5-a]pyrimidin-3-yl)ethyl]-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCCc1cnn2ccc(Cl)nc12 |
| InChI | InChI=1S/C15H14ClN5O4S/c1-10-2-3-12(21(22)23)8-13(10)26(24,25)18-6-4-11-9-17-20-7-5-14(16)19-15(11)20/h2-3,5,7-9,18H,4,6H2,1H3 |
| InChIKey | FAWULGGSSGGIAH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|