About 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol
3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol (PubChem CID 122188412) has the molecular formula C22H15NO2S
and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol.
Molecular Properties
| Compound Name | 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol |
| PubChem CID | 122188412 |
| Molecular Formula | C22H15NO2S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol |
| SMILES | Oc1cccc(-c2cc(-c3ccsc3)nc3c2COc2ccccc2-3)c1 |
| InChI | InChI=1S/C22H15NO2S/c24-16-5-3-4-14(10-16)18-11-20(15-8-9-26-13-15)23-22-17-6-1-2-7-21(17)25-12-19(18)22/h1-11,13,24H,12H2 |
| InChIKey | DZSOBUFRUUNECZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol?
The IUPAC name of 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol (CID 122188412) is 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol.
What is the SMILES notation for 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol?
The canonical SMILES for 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol is Oc1cccc(-c2cc(-c3ccsc3)nc3c2COc2ccccc2-3)c1.
What is the InChIKey of 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol?
The InChIKey is DZSOBUFRUUNECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO2S/c24-16-5-3-4-14(10-16)18-11-20(15-8-9-26-13-15)23-22-17-6-1-2-7-21(17)25-12-19(18)22/h1-11,13,24H,12H2.
What are the key properties of 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol?
3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol has a molecular weight of 357.43 g/mol, XLogP of 5.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-thiophen-3-yl-5H-chromeno[4,3-b]pyridin-4-yl)phenol is sourced from PubChem (CID 122188412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).