C23H22N4O4 — CID 122188468
N-(3-morpholin-4-ylpropyl)-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxamide (PubChem CID 122188468) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 122188468 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-5,12-dioxoindolizino[2,3-g]quinoline-6-carboxamide |
| SMILES | O=C1c2cccnc2C(=O)c2c1c(C(=O)NCCCN1CCOCC1)c1ccccn21 |
| InChI | InChI=1S/C23H22N4O4/c28-21-15-5-3-7-24-19(15)22(29)20-18(21)17(16-6-1-2-10-27(16)20)23(30)25-8-4-9-26-11-13-31-14-12-26/h1-3,5-7,10H,4,8-9,11-14H2,(H,25,30) |
| InChIKey | NUWCCXCRLCHTKR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|