C24H23N3O4 — CID 122188474
3-piperidin-1-ylpropyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate (PubChem CID 122188474) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate.
| Compound Name | 3-piperidin-1-ylpropyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 122188474 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-piperidin-1-ylpropyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
| SMILES | O=C1c2cccnc2C(=O)c2c1c(C(=O)OCCCN1CCCCC1)c1ccccn21 |
| InChI | InChI=1S/C24H23N3O4/c28-22-16-8-6-10-25-20(16)23(29)21-19(22)18(17-9-2-5-14-27(17)21)24(30)31-15-7-13-26-11-3-1-4-12-26/h2,5-6,8-10,14H,1,3-4,7,11-13,15H2 |
| InChIKey | DVZCMBJSRRXMRW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|