About S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate
S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate (PubChem CID 122188492) has the molecular formula C22H22O6S2
and a molecular weight of 446.55 g/mol. Its IUPAC name is S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate.
Molecular Properties
| Compound Name | S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate |
| PubChem CID | 122188492 |
| Molecular Formula | C22H22O6S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate |
| SMILES | COc1ccc(/C=C/C(=O)SSC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H22O6S2/c1-25-17-9-5-15(13-19(17)27-3)7-11-21(23)29-30-22(24)12-8-16-6-10-18(26-2)20(14-16)28-4/h5-14H,1-4H3/b11-7+,12-8+ |
| InChIKey | CYGXBVOSCODRDJ-MKICQXMISA-N |
| XLogP | 4.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate?
The IUPAC name of S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate (CID 122188492) is S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate.
What is the SMILES notation for S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate?
The canonical SMILES for S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate is COc1ccc(/C=C/C(=O)SSC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1OC.
What is the InChIKey of S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate?
The InChIKey is CYGXBVOSCODRDJ-MKICQXMISA-N. The full InChI is InChI=1S/C22H22O6S2/c1-25-17-9-5-15(13-19(17)27-3)7-11-21(23)29-30-22(24)12-8-16-6-10-18(26-2)20(14-16)28-4/h5-14H,1-4H3/b11-7+,12-8+.
What are the key properties of S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate?
S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate has a molecular weight of 446.55 g/mol, XLogP of 4.88, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]sulfanyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enethioate is sourced from PubChem (CID 122188492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).