C18H19F3N2O2S — CID 122188538
N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 122188538) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 122188538 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCCCN1c2ccccc2CCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O2S/c19-18(20,21)26(24,25)22-12-5-13-23-16-8-3-1-6-14(16)10-11-15-7-2-4-9-17(15)23/h1-4,6-9,22H,5,10-13H2 |
| InChIKey | CNLZRSHORPPOLF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|