C28H25F3O3S — CID 122188545
2-[4-[4-(trifluoromethoxy)phenyl]sulfonylcyclohexylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 122188545) has the molecular formula C28H25F3O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethoxy)phenyl]sulfonylcyclohexylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | 2-[4-[4-(trifluoromethoxy)phenyl]sulfonylcyclohexylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 122188545 |
| Molecular Formula | C28H25F3O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-[4-[4-(trifluoromethoxy)phenyl]sulfonylcyclohexylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)C1CCC(=C2c3ccccc3CCc3ccccc32)CC1 |
| InChI | InChI=1S/C28H25F3O3S/c29-28(30,31)34-22-13-17-24(18-14-22)35(32,33)23-15-11-21(12-16-23)27-25-7-3-1-5-19(25)9-10-20-6-2-4-8-26(20)27/h1-8,13-14,17-18,23H,9-12,15-16H2 |
| InChIKey | CAQNUJOSWDXPOL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|