C23H25ClN6O3S — CID 122188572
(1S,2R,3S,4R,5S)-4-[6-(butylamino)-2-[2-(5-chlorothiophen-2-yl)ethynyl]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 122188572) has the molecular formula C23H25ClN6O3S and a molecular weight of 501.01 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4-[6-(butylamino)-2-[2-(5-chlorothiophen-2-yl)ethynyl]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R,5S)-4-[6-(butylamino)-2-[2-(5-chlorothiophen-2-yl)ethynyl]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 122188572 |
| Molecular Formula | C23H25ClN6O3S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4-[6-(butylamino)-2-[2-(5-chlorothiophen-2-yl)ethynyl]purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CCCCNc1nc(C#Cc2ccc(Cl)s2)nc2c1ncn2[C@H]1[C@H](O)[C@H](O)[C@]2(C(=O)NC)C[C@H]12 |
| InChI | InChI=1S/C23H25ClN6O3S/c1-3-4-9-26-20-16-21(29-15(28-20)8-6-12-5-7-14(24)34-12)30(11-27-16)17-13-10-23(13,22(33)25-2)19(32)18(17)31/h5,7,11,13,17-19,31-32H,3-4,9-10H2,1-2H3,(H,25,33)(H,26,28,29)/t13-,17-,18+,19+,23+/m1/s1 |
| InChIKey | AQICAVVSPZOFNC-VYYPKGNMSA-N |
| XLogP | 2.18 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|