C23H23ClN6O3S — CID 122188576
(1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 122188576) has the molecular formula C23H23ClN6O3S and a molecular weight of 499.00 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 122188576 |
| Molecular Formula | C23H23ClN6O3S |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclopropylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(NCC4CC4)nc(C#Cc4ccc(Cl)s4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C23H23ClN6O3S/c1-25-22(33)23-8-13(23)17(18(31)19(23)32)30-10-27-16-20(26-9-11-2-3-11)28-15(29-21(16)30)7-5-12-4-6-14(24)34-12/h4,6,10-11,13,17-19,31-32H,2-3,8-9H2,1H3,(H,25,33)(H,26,28,29)/t13-,17-,18+,19+,23+/m1/s1 |
| InChIKey | SKIVTDUDCHYPDY-VYYPKGNMSA-N |
| XLogP | 1.79 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|