C24H25ClN6O3S — CID 122188577
(1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclobutylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 122188577) has the molecular formula C24H25ClN6O3S and a molecular weight of 513.02 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclobutylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclobutylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 122188577 |
| Molecular Formula | C24H25ClN6O3S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | (1S,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(cyclobutylmethylamino)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@@]12C[C@@H]1[C@@H](n1cnc3c(NCC4CCC4)nc(C#Cc4ccc(Cl)s4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C24H25ClN6O3S/c1-26-23(34)24-9-14(24)18(19(32)20(24)33)31-11-28-17-21(27-10-12-3-2-4-12)29-16(30-22(17)31)8-6-13-5-7-15(25)35-13/h5,7,11-12,14,18-20,32-33H,2-4,9-10H2,1H3,(H,26,34)(H,27,29,30)/t14-,18-,19+,20+,24+/m1/s1 |
| InChIKey | NWASDXLELXICHM-BONGUKEGSA-N |
| XLogP | 2.18 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|