About N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide
N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 122188588) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide |
| PubChem CID | 122188588 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | Cc1ccn2nc(C)c(C(=O)NCc3ccc(N(C)C)cc3)c2c1 |
| InChI | InChI=1S/C19H22N4O/c1-13-9-10-23-17(11-13)18(14(2)21-23)19(24)20-12-15-5-7-16(8-6-15)22(3)4/h5-11H,12H2,1-4H3,(H,20,24) |
| InChIKey | ZNDQTKOOJXXHGB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide?
The IUPAC name of N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide (CID 122188588) is N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide.
What is the SMILES notation for N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide?
The canonical SMILES for N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide is Cc1ccn2nc(C)c(C(=O)NCc3ccc(N(C)C)cc3)c2c1.
What is the InChIKey of N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide?
The InChIKey is ZNDQTKOOJXXHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O/c1-13-9-10-23-17(11-13)18(14(2)21-23)19(24)20-12-15-5-7-16(8-6-15)22(3)4/h5-11H,12H2,1-4H3,(H,20,24).
What are the key properties of N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide?
N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide has a molecular weight of 322.41 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(dimethylamino)phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide is sourced from PubChem (CID 122188588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).