C27H28FN5O — CID 122188592
N-[[4-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 122188592) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[[4-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[[4-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122188592 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[[4-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]methyl]-2,5-dimethylpyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | Cc1ccn2nc(C)c(C(=O)NCc3ccc(N4CCN(c5ccc(F)cc5)CC4)cc3)c2c1 |
| InChI | InChI=1S/C27H28FN5O/c1-19-11-12-33-25(17-19)26(20(2)30-33)27(34)29-18-21-3-7-23(8-4-21)31-13-15-32(16-14-31)24-9-5-22(28)6-10-24/h3-12,17H,13-16,18H2,1-2H3,(H,29,34) |
| InChIKey | YIUQAZFHIQWXJU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|