C34H31F3N4O2 — CID 122188604
2-methyl-5-phenyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 122188604) has the molecular formula C34H31F3N4O2 and a molecular weight of 584.64 g/mol. Its IUPAC name is 2-methyl-5-phenyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 2-methyl-5-phenyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122188604 |
| Molecular Formula | C34H31F3N4O2 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 2-methyl-5-phenyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperidin-1-yl]phenyl]methyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | Cc1nn2ccc(-c3ccccc3)cc2c1C(=O)NCc1ccc(N2CCC(c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C34H31F3N4O2/c1-23-32(31-21-28(17-20-41(31)39-23)25-5-3-2-4-6-25)33(42)38-22-24-7-11-29(12-8-24)40-18-15-27(16-19-40)26-9-13-30(14-10-26)43-34(35,36)37/h2-14,17,20-21,27H,15-16,18-19,22H2,1H3,(H,38,42) |
| InChIKey | UJCOSSAKIUTVGY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|