About 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate
8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate (PubChem CID 122188672) has the molecular formula C26H35N3O7
and a molecular weight of 501.58 g/mol. Its IUPAC name is 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| PubChem CID | 122188672 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)OCCCCCCCCc2cnnn2CCCO)cc1OC(C)=O |
| InChI | InChI=1S/C26H35N3O7/c1-20(31)35-24-13-11-22(18-25(24)36-21(2)32)12-14-26(33)34-17-8-6-4-3-5-7-10-23-19-27-28-29(23)15-9-16-30/h11-14,18-19,30H,3-10,15-17H2,1-2H3/b14-12+ |
| InChIKey | CAVBFQXQFHVKJH-WYMLVPIESA-N |
| XLogP | 3.65 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate?
The IUPAC name of 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate (CID 122188672) is 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate.
What is the SMILES notation for 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate?
The canonical SMILES for 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate is CC(=O)Oc1ccc(/C=C/C(=O)OCCCCCCCCc2cnnn2CCCO)cc1OC(C)=O.
What is the InChIKey of 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate?
The InChIKey is CAVBFQXQFHVKJH-WYMLVPIESA-N. The full InChI is InChI=1S/C26H35N3O7/c1-20(31)35-24-13-11-22(18-25(24)36-21(2)32)12-14-26(33)34-17-8-6-4-3-5-7-10-23-19-27-28-29(23)15-9-16-30/h11-14,18-19,30H,3-10,15-17H2,1-2H3/b14-12+.
What are the key properties of 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate?
8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate has a molecular weight of 501.58 g/mol, XLogP of 3.65, 16 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3-(3-hydroxypropyl)triazol-4-yl]octyl (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate is sourced from PubChem (CID 122188672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).