C34H36N2O5 — CID 122188931
4-[4-[2-[[4-(2-methylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid (PubChem CID 122188931) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 4-[4-[2-[[4-(2-methylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[[4-(2-methylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 122188931 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 4-[4-[2-[[4-(2-methylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
| SMILES | Cc1ccccc1-c1ccc(C(=O)NCCNC(=O)c2ccc(OC3C4CC5CC3CC(C(=O)O)(C5)C4)cc2)cc1 |
| InChI | InChI=1S/C34H36N2O5/c1-21-4-2-3-5-29(21)23-6-8-24(9-7-23)31(37)35-14-15-36-32(38)25-10-12-28(13-11-25)41-30-26-16-22-17-27(30)20-34(18-22,19-26)33(39)40/h2-13,22,26-27,30H,14-20H2,1H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | JNHUICIANQTFML-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|