C35H38N2O5 — CID 122188935
4-[4-[2-[[4-(2,6-dimethylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid (PubChem CID 122188935) has the molecular formula C35H38N2O5 and a molecular weight of 566.70 g/mol. Its IUPAC name is 4-[4-[2-[[4-(2,6-dimethylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid.
| Compound Name | 4-[4-[2-[[4-(2,6-dimethylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 122188935 |
| Molecular Formula | C35H38N2O5 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 4-[4-[2-[[4-(2,6-dimethylphenyl)benzoyl]amino]ethylcarbamoyl]phenoxy]adamantane-1-carboxylic acid |
| SMILES | Cc1cccc(C)c1-c1ccc(C(=O)NCCNC(=O)c2ccc(OC3C4CC5CC3CC(C(=O)O)(C5)C4)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O5/c1-21-4-3-5-22(2)30(21)24-6-8-25(9-7-24)32(38)36-14-15-37-33(39)26-10-12-29(13-11-26)42-31-27-16-23-17-28(31)20-35(18-23,19-27)34(40)41/h3-13,23,27-28,31H,14-20H2,1-2H3,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | NUGYHMCKGBYXDD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|