C21H21FO3S — CID 122188958
(3S,3aS,5aS,9bS)-3-[(4-fluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 122188958) has the molecular formula C21H21FO3S and a molecular weight of 372.46 g/mol. Its IUPAC name is (3S,3aS,5aS,9bS)-3-[(4-fluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,3aS,5aS,9bS)-3-[(4-fluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 122188958 |
| Molecular Formula | C21H21FO3S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (3S,3aS,5aS,9bS)-3-[(4-fluorophenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@@H](CSc4ccc(F)cc4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C21H21FO3S/c1-12-17(23)8-10-21(2)9-7-15-16(20(24)25-19(15)18(12)21)11-26-14-5-3-13(22)4-6-14/h3-6,8,10,15-16,19H,7,9,11H2,1-2H3/t15-,16-,19-,21-/m0/s1 |
| InChIKey | QQAHGXCMYLCJER-UGJIMAENSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |