C22H24O3S — CID 122188963
(3S,3aS,5aS,9bS)-5a,9-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 122188963) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is (3S,3aS,5aS,9bS)-5a,9-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,3aS,5aS,9bS)-5a,9-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 122188963 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (3S,3aS,5aS,9bS)-5a,9-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@@H](CSc4ccccc4C)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C22H24O3S/c1-13-6-4-5-7-18(13)26-12-16-15-8-10-22(3)11-9-17(23)14(2)19(22)20(15)25-21(16)24/h4-7,9,11,15-16,20H,8,10,12H2,1-3H3/t15-,16-,20-,22-/m0/s1 |
| InChIKey | ZGGHJITZEADFQH-RDAXPCIFSA-N |
| XLogP | 4.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |