C22H23BrO3S — CID 122188966
(3S,3aS,5aS,9bS)-3-[(3-bromo-4-methylphenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 122188966) has the molecular formula C22H23BrO3S and a molecular weight of 447.39 g/mol. Its IUPAC name is (3S,3aS,5aS,9bS)-3-[(3-bromo-4-methylphenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,3aS,5aS,9bS)-3-[(3-bromo-4-methylphenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 122188966 |
| Molecular Formula | C22H23BrO3S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (3S,3aS,5aS,9bS)-3-[(3-bromo-4-methylphenyl)sulfanylmethyl]-5a,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@@H](CSc4ccc(C)c(Br)c4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C22H23BrO3S/c1-12-4-5-14(10-17(12)23)27-11-16-15-6-8-22(3)9-7-18(24)13(2)19(22)20(15)26-21(16)25/h4-5,7,9-10,15-16,20H,6,8,11H2,1-3H3/t15-,16-,20-,22-/m0/s1 |
| InChIKey | QSMGFMQOHGBNLB-RDAXPCIFSA-N |
| XLogP | 5.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |