About benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate
benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate (PubChem CID 122189077) has the molecular formula C30H22N4O2
and a molecular weight of 470.53 g/mol. Its IUPAC name is benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate |
| PubChem CID | 122189077 |
| Molecular Formula | C30H22N4O2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1ccc2nc(-c3cn(-c4ccccc4)nc3-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C30H22N4O2/c35-30(36-20-21-10-4-1-5-11-21)23-16-17-26-27(18-23)32-29(31-26)25-19-34(24-14-8-3-9-15-24)33-28(25)22-12-6-2-7-13-22/h1-19H,20H2,(H,31,32) |
| InChIKey | HTDLRKJEGBTVBV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate?
The IUPAC name of benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate (CID 122189077) is benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate.
What is the SMILES notation for benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate?
The canonical SMILES for benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate is O=C(OCc1ccccc1)c1ccc2nc(-c3cn(-c4ccccc4)nc3-c3ccccc3)[nH]c2c1.
What is the InChIKey of benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate?
The InChIKey is HTDLRKJEGBTVBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N4O2/c35-30(36-20-21-10-4-1-5-11-21)23-16-17-26-27(18-23)32-29(31-26)25-19-34(24-14-8-3-9-15-24)33-28(25)22-12-6-2-7-13-22/h1-19H,20H2,(H,31,32).
What are the key properties of benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate?
benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate has a molecular weight of 470.53 g/mol, XLogP of 6.44, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(1,3-diphenylpyrazol-4-yl)-3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 122189077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).