About CID 122189271
CID 122189271 (PubChem CID 122189271) has the molecular formula C18H27NO5
and a molecular weight of 337.42 g/mol.
Molecular Properties
| Compound Name | CID 122189271 |
| PubChem CID | 122189271 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | — |
| SMILES | O=C(NO)C1CCC2(CC1)OCC1(OO2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H27NO5/c20-16(19-21)13-1-3-17(4-2-13)22-10-18(24-23-17)14-6-11-5-12(8-14)9-15(18)7-11/h11-15,21H,1-10H2,(H,19,20) |
| InChIKey | POMPXAFWNWEYED-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 122189271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122189271?
The IUPAC name of CID 122189271 (CID 122189271) is not available.
What is the SMILES notation for CID 122189271?
The canonical SMILES for CID 122189271 is O=C(NO)C1CCC2(CC1)OCC1(OO2)C2CC3CC(C2)CC1C3.
What is the InChIKey of CID 122189271?
The InChIKey is POMPXAFWNWEYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO5/c20-16(19-21)13-1-3-17(4-2-13)22-10-18(24-23-17)14-6-11-5-12(8-14)9-15(18)7-11/h11-15,21H,1-10H2,(H,19,20).
What are the key properties of CID 122189271?
CID 122189271 has a molecular weight of 337.42 g/mol, XLogP of 2.55, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122189271 is sourced from PubChem (CID 122189271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).