C24H50O3Si2 — CID 122189278
[(1R,3S,4aS,5R,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-triethylsilyloxy-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]methanol (PubChem CID 122189278) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is [(1R,3S,4aS,5R,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-triethylsilyloxy-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]methanol.
| Compound Name | [(1R,3S,4aS,5R,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-triethylsilyloxy-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 122189278 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | [(1R,3S,4aS,5R,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-triethylsilyloxy-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CCC[C@@H]2[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C)CO |
| InChI | InChI=1S/C24H50O3Si2/c1-10-29(11-2,12-3)27-22-15-13-14-21-20(22)16-19(17-24(21,7)18-25)26-28(8,9)23(4,5)6/h19-22,25H,10-18H2,1-9H3/t19-,20-,21+,22+,24-/m0/s1 |
| InChIKey | HCEBHRBVUGDERV-UQUMJBAASA-N |
| XLogP | 6.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|