C29H42ClN5O6 — CID 122189328
methyl (2S)-2-[[(2S)-1-[[(3E,5S,8S)-5-[(2-chlorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate (PubChem CID 122189328) has the molecular formula C29H42ClN5O6 and a molecular weight of 592.14 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-1-[[(3E,5S,8S)-5-[(2-chlorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S)-1-[[(3E,5S,8S)-5-[(2-chlorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 122189328 |
| Molecular Formula | C29H42ClN5O6 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | methyl (2S)-2-[[(2S)-1-[[(3E,5S,8S)-5-[(2-chlorophenyl)methyl]-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)N[C@H](C(=O)N[C@H]1CCCCNC(=O)/C=C/[C@H](Cc2ccccc2Cl)NC1=O)C(C)C)C(C)C |
| InChI | InChI=1S/C29H42ClN5O6/c1-17(2)24(34-29(40)35-25(18(3)4)28(39)41-5)27(38)33-22-12-8-9-15-31-23(36)14-13-20(32-26(22)37)16-19-10-6-7-11-21(19)30/h6-7,10-11,13-14,17-18,20,22,24-25H,8-9,12,15-16H2,1-5H3,(H,31,36)(H,32,37)(H,33,38)(H2,34,35,40)/b14-13+/t20-,22+,24+,25+/m1/s1 |
| InChIKey | AFWAZXTYYMCYAV-NUAOEIINSA-N |
| XLogP | 2.23 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |