C24H26ClN5 — CID 122189362
1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-methyl-3-phenylpyrazole-4-carbonitrile (PubChem CID 122189362) has the molecular formula C24H26ClN5 and a molecular weight of 419.96 g/mol. Its IUPAC name is 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-methyl-3-phenylpyrazole-4-carbonitrile.
| Compound Name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-methyl-3-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 122189362 |
| Molecular Formula | C24H26ClN5 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-methyl-3-phenylpyrazole-4-carbonitrile |
| SMILES | Cc1c(C#N)c(-c2ccccc2)nn1CCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H26ClN5/c1-19-23(18-26)24(20-7-3-2-4-8-20)27-30(19)12-6-11-28-13-15-29(16-14-28)22-10-5-9-21(25)17-22/h2-5,7-10,17H,6,11-16H2,1H3 |
| InChIKey | IRPMMBYAHGHGIN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |