About 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate (PubChem CID 122189411) has the molecular formula C20H19N3O5
and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate |
| PubChem CID | 122189411 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H19N3O5/c1-15-21-13-19(23(25)26)22(15)11-12-27-20(24)17-9-5-6-10-18(17)28-14-16-7-3-2-4-8-16/h2-10,13H,11-12,14H2,1H3 |
| InChIKey | LJYDCJWQJKECHR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate?
The IUPAC name of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate (CID 122189411) is 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate.
What is the SMILES notation for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate?
The canonical SMILES for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate is Cc1ncc([N+](=O)[O-])n1CCOC(=O)c1ccccc1OCc1ccccc1.
What is the InChIKey of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate?
The InChIKey is LJYDCJWQJKECHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O5/c1-15-21-13-19(23(25)26)22(15)11-12-27-20(24)17-9-5-6-10-18(17)28-14-16-7-3-2-4-8-16/h2-10,13H,11-12,14H2,1H3.
What are the key properties of 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate?
2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate has a molecular weight of 381.39 g/mol, XLogP of 3.54, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylmethoxybenzoate is sourced from PubChem (CID 122189411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).