C23H21N3O4S — CID 122189465
N-(2-cyanophenyl)-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide (PubChem CID 122189465) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide.
| Compound Name | N-(2-cyanophenyl)-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 122189465 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-(2-cyanophenyl)-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide |
| SMILES | N#Cc1ccccc1NC(=O)COc1ccc(S(=O)(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O4S/c24-16-19-8-4-5-9-22(19)26-23(27)17-30-20-10-12-21(13-11-20)31(28,29)25-15-14-18-6-2-1-3-7-18/h1-13,25H,14-15,17H2,(H,26,27) |
| InChIKey | OBYQJDBLXIBZCB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |