C27H28FN3O3 — CID 122189494
N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-methoxybenzamide (PubChem CID 122189494) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-methoxybenzamide.
| Compound Name | N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 122189494 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2c3cc(/N=C(\C)N(C)Cc4ccc(F)cc4)ccc3C[C@H]2O)cc1 |
| InChI | InChI=1S/C27H28FN3O3/c1-17(31(2)16-18-4-9-21(28)10-5-18)29-22-11-6-20-14-25(32)26(24(20)15-22)30-27(33)19-7-12-23(34-3)13-8-19/h4-13,15,25-26,32H,14,16H2,1-3H3,(H,30,33)/b29-17+/t25-,26-/m1/s1 |
| InChIKey | VUHFTOXCJSJPEQ-WIVNOQECSA-N |
| XLogP | 4.40 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|