C14H12NNa3O6 — CID 122189595
trisodium;4-[[carboxylatomethyl(prop-2-enyl)amino]methyl]phthalate (PubChem CID 122189595) has the molecular formula C14H12NNa3O6 and a molecular weight of 359.22 g/mol. Its IUPAC name is trisodium;4-[[carboxylatomethyl(prop-2-enyl)amino]methyl]phthalate.
| Compound Name | trisodium;4-[[carboxylatomethyl(prop-2-enyl)amino]methyl]phthalate |
|---|---|
| PubChem CID | 122189595 |
| Molecular Formula | C14H12NNa3O6 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | trisodium;4-[[carboxylatomethyl(prop-2-enyl)amino]methyl]phthalate |
| SMILES | C=CCN(CC(=O)[O-])Cc1ccc(C(=O)[O-])c(C(=O)[O-])c1.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C14H15NO6.3Na/c1-2-5-15(8-12(16)17)7-9-3-4-10(13(18)19)11(6-9)14(20)21;;;/h2-4,6H,1,5,7-8H2,(H,16,17)(H,18,19)(H,20,21);;;/q;3*+1/p-3 |
| InChIKey | PRCQHZDUKZPLAO-UHFFFAOYSA-K |
| XLogP | -11.84 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | -11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|