C26H39NO — CID 122190108
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]cyclopentanecarboxamide (PubChem CID 122190108) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 122190108 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]cyclopentanecarboxamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNC(=O)C3CCCC3)CCC[C@]21C |
| InChI | InChI=1S/C26H39NO/c1-18(2)20-10-12-22-21(16-20)11-13-23-25(3,14-7-15-26(22,23)4)17-27-24(28)19-8-5-6-9-19/h10,12,16,18-19,23H,5-9,11,13-15,17H2,1-4H3,(H,27,28)/t23-,25-,26+/m0/s1 |
| InChIKey | YQJFFNINYOYRIR-AYRHNUGRSA-N |
| XLogP | 6.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |