C27H41NO — CID 122190109
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-cyclopentylacetamide (PubChem CID 122190109) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-cyclopentylacetamide.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 122190109 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-2-cyclopentylacetamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNC(=O)CC3CCCC3)CCC[C@]21C |
| InChI | InChI=1S/C27H41NO/c1-19(2)21-10-12-23-22(17-21)11-13-24-26(3,14-7-15-27(23,24)4)18-28-25(29)16-20-8-5-6-9-20/h10,12,17,19-20,24H,5-9,11,13-16,18H2,1-4H3,(H,28,29)/t24-,26-,27+/m0/s1 |
| InChIKey | SPXIIKWDSQIKKB-DOEKTCAHSA-N |
| XLogP | 6.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |