C26H33Cl2NO3S — CID 122190132
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide (PubChem CID 122190132) has the molecular formula C26H33Cl2NO3S and a molecular weight of 510.53 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 122190132 |
| Molecular Formula | C26H33Cl2NO3S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CNS(=O)(=O)c3cc(Cl)cc(Cl)c3O)CCC[C@]21C |
| InChI | InChI=1S/C26H33Cl2NO3S/c1-16(2)17-6-8-20-18(12-17)7-9-23-25(3,10-5-11-26(20,23)4)15-29-33(31,32)22-14-19(27)13-21(28)24(22)30/h6,8,12-14,16,23,29-30H,5,7,9-11,15H2,1-4H3/t23-,25-,26+/m0/s1 |
| InChIKey | IOWHCIAPDTUTDC-AYRHNUGRSA-N |
| XLogP | 6.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|