C18H20F3N5S — CID 122190190
4-N-[3-(dimethylamino)propyl]-6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 122190190) has the molecular formula C18H20F3N5S and a molecular weight of 395.45 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 122190190 |
| Molecular Formula | C18H20F3N5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(N)nc2cc(-c3ccc(C(F)(F)F)cc3)sc12 |
| InChI | InChI=1S/C18H20F3N5S/c1-26(2)9-3-8-23-16-15-13(24-17(22)25-16)10-14(27-15)11-4-6-12(7-5-11)18(19,20)21/h4-7,10H,3,8-9H2,1-2H3,(H3,22,23,24,25) |
| InChIKey | HJLJYZKCNPRLNM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|