C18H19F3N4S — CID 122190192
N',N'-dimethyl-N-[6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-yl]propane-1,3-diamine (PubChem CID 122190192) has the molecular formula C18H19F3N4S and a molecular weight of 380.44 g/mol. Its IUPAC name is N',N'-dimethyl-N-[6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 122190192 |
| Molecular Formula | C18H19F3N4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N',N'-dimethyl-N-[6-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1ncnc2cc(-c3ccc(C(F)(F)F)cc3)sc12 |
| InChI | InChI=1S/C18H19F3N4S/c1-25(2)9-3-8-22-17-16-14(23-11-24-17)10-15(26-16)12-4-6-13(7-5-12)18(19,20)21/h4-7,10-11H,3,8-9H2,1-2H3,(H,22,23,24) |
| InChIKey | SWLPEWFKWLJVDC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|