C11H24N2O6S — CID 122190238
(2S,3S,4R,5R)-2-(hexylsulfamoylamino)oxane-3,4,5-triol (PubChem CID 122190238) has the molecular formula C11H24N2O6S and a molecular weight of 312.39 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(hexylsulfamoylamino)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-(hexylsulfamoylamino)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 122190238 |
| Molecular Formula | C11H24N2O6S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2S,3S,4R,5R)-2-(hexylsulfamoylamino)oxane-3,4,5-triol |
| SMILES | CCCCCCNS(=O)(=O)N[C@H]1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H24N2O6S/c1-2-3-4-5-6-12-20(17,18)13-11-10(16)9(15)8(14)7-19-11/h8-16H,2-7H2,1H3/t8-,9-,10+,11+/m1/s1 |
| InChIKey | TVDMFLMVSZNGQT-ZNSHCXBVSA-N |
| XLogP | -1.57 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|