About methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate
methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate (PubChem CID 122190266) has the molecular formula C24H32O3Si
and a molecular weight of 396.60 g/mol. Its IUPAC name is methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate.
Molecular Properties
| Compound Name | methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate |
| PubChem CID | 122190266 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H32O3Si/c1-18(23(25)26-5)21(19-14-10-8-11-15-19)22(20-16-12-9-13-17-20)27-28(6,7)24(2,3)4/h8-17,21-22H,1H2,2-7H3/t21-,22+/m0/s1 |
| InChIKey | BYIYOKKWABXPFQ-FCHUYYIVSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate?
The IUPAC name of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate (CID 122190266) is methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate.
What is the SMILES notation for methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate?
The canonical SMILES for methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate is C=C(C(=O)OC)[C@@H](c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1.
What is the InChIKey of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate?
The InChIKey is BYIYOKKWABXPFQ-FCHUYYIVSA-N. The full InChI is InChI=1S/C24H32O3Si/c1-18(23(25)26-5)21(19-14-10-8-11-15-19)22(20-16-12-9-13-17-20)27-28(6,7)24(2,3)4/h8-17,21-22H,1H2,2-7H3/t21-,22+/m0/s1.
What are the key properties of methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate?
methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate has a molecular weight of 396.60 g/mol, XLogP of 6.26, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidene-3,4-diphenylbutanoate is sourced from PubChem (CID 122190266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).