C23H18O2 — CID 122190272
(3E,4R,5S)-3-benzylidene-4,5-diphenyloxolan-2-one (PubChem CID 122190272) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3E,4R,5S)-3-benzylidene-4,5-diphenyloxolan-2-one.
| Compound Name | (3E,4R,5S)-3-benzylidene-4,5-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 122190272 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (3E,4R,5S)-3-benzylidene-4,5-diphenyloxolan-2-one |
| SMILES | O=C1O[C@H](c2ccccc2)[C@H](c2ccccc2)/C1=C\c1ccccc1 |
| InChI | InChI=1S/C23H18O2/c24-23-20(16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)22(25-23)19-14-8-3-9-15-19/h1-16,21-22H/b20-16+/t21-,22-/m1/s1 |
| InChIKey | WOUVIGYBUKMNJW-QRTWOMCZSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|