C30H34F3N5O3 — CID 122190364
(3R)-1-[6-[[4,4,4-trifluoro-1-[2-methyl-4-(4,5,6,7-tetrahydroindazol-2-yl)phenyl]butyl]amino]pyridine-3-carbonyl]piperidine-3-carboxylic acid (PubChem CID 122190364) has the molecular formula C30H34F3N5O3 and a molecular weight of 569.63 g/mol. Its IUPAC name is (3R)-1-[6-[[4,4,4-trifluoro-1-[2-methyl-4-(4,5,6,7-tetrahydroindazol-2-yl)phenyl]butyl]amino]pyridine-3-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[6-[[4,4,4-trifluoro-1-[2-methyl-4-(4,5,6,7-tetrahydroindazol-2-yl)phenyl]butyl]amino]pyridine-3-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122190364 |
| Molecular Formula | C30H34F3N5O3 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | (3R)-1-[6-[[4,4,4-trifluoro-1-[2-methyl-4-(4,5,6,7-tetrahydroindazol-2-yl)phenyl]butyl]amino]pyridine-3-carbonyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cc(-n2cc3c(n2)CCCC3)ccc1C(CCC(F)(F)F)Nc1ccc(C(=O)N2CCC[C@@H](C(=O)O)C2)cn1 |
| InChI | InChI=1S/C30H34F3N5O3/c1-19-15-23(38-18-21-5-2-3-7-25(21)36-38)9-10-24(19)26(12-13-30(31,32)33)35-27-11-8-20(16-34-27)28(39)37-14-4-6-22(17-37)29(40)41/h8-11,15-16,18,22,26H,2-7,12-14,17H2,1H3,(H,34,35)(H,40,41)/t22-,26?/m1/s1 |
| InChIKey | JNFRSIVSORDPKM-FPSALIRRSA-N |
| XLogP | 5.89 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |