C34H41N9O2 — CID 122190501
N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-7-(4-methyl-2-phenylpiperazin-1-yl)-7-oxoheptanamide (PubChem CID 122190501) has the molecular formula C34H41N9O2 and a molecular weight of 607.76 g/mol. Its IUPAC name is N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-7-(4-methyl-2-phenylpiperazin-1-yl)-7-oxoheptanamide.
| Compound Name | N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-7-(4-methyl-2-phenylpiperazin-1-yl)-7-oxoheptanamide |
|---|---|
| PubChem CID | 122190501 |
| Molecular Formula | C34H41N9O2 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]phenyl]-7-(4-methyl-2-phenylpiperazin-1-yl)-7-oxoheptanamide |
| SMILES | CN1CCN(C(=O)CCCCCC(=O)Nc2cccc(Nc3nccc(Nc4cc(C5CC5)[nH]n4)n3)c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C34H41N9O2/c1-42-19-20-43(29(23-42)25-9-4-2-5-10-25)33(45)14-7-3-6-13-32(44)36-26-11-8-12-27(21-26)37-34-35-18-17-30(39-34)38-31-22-28(40-41-31)24-15-16-24/h2,4-5,8-12,17-18,21-22,24,29H,3,6-7,13-16,19-20,23H2,1H3,(H,36,44)(H3,35,37,38,39,40,41) |
| InChIKey | IIUNRDLMIHCWET-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|