About 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione
2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione (PubChem CID 122190514) has the molecular formula C19H17Cl2NO4
and a molecular weight of 394.25 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione.
Molecular Properties
| Compound Name | 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione |
| PubChem CID | 122190514 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(CN(CCCl)CCCl)cc(O)c21 |
| InChI | InChI=1S/C19H17Cl2NO4/c20-5-7-22(8-6-21)10-11-9-14(23)15-16(17(11)24)19(26)13-4-2-1-3-12(13)18(15)25/h1-4,9,23-24H,5-8,10H2 |
| InChIKey | PCRAINYXUPQFIA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione?
The IUPAC name of 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione (CID 122190514) is 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione.
What is the SMILES notation for 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione?
The canonical SMILES for 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione is O=C1c2ccccc2C(=O)c2c(O)c(CN(CCCl)CCCl)cc(O)c21.
What is the InChIKey of 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione?
The InChIKey is PCRAINYXUPQFIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2NO4/c20-5-7-22(8-6-21)10-11-9-14(23)15-16(17(11)24)19(26)13-4-2-1-3-12(13)18(15)25/h1-4,9,23-24H,5-8,10H2.
What are the key properties of 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione?
2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione has a molecular weight of 394.25 g/mol, XLogP of 3.15, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-chloroethyl)aminomethyl]-1,4-dihydroxyanthracene-9,10-dione is sourced from PubChem (CID 122190514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).