C27H25Cl2NO4 — CID 122190615
2-[bis(2-chloroethyl)amino-(3,4-dimethylphenyl)methyl]-1,4-dihydroxyanthracene-9,10-dione (PubChem CID 122190615) has the molecular formula C27H25Cl2NO4 and a molecular weight of 498.41 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)amino-(3,4-dimethylphenyl)methyl]-1,4-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-[bis(2-chloroethyl)amino-(3,4-dimethylphenyl)methyl]-1,4-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 122190615 |
| Molecular Formula | C27H25Cl2NO4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[bis(2-chloroethyl)amino-(3,4-dimethylphenyl)methyl]-1,4-dihydroxyanthracene-9,10-dione |
| SMILES | Cc1ccc(C(c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)N(CCCl)CCCl)cc1C |
| InChI | InChI=1S/C27H25Cl2NO4/c1-15-7-8-17(13-16(15)2)24(30(11-9-28)12-10-29)20-14-21(31)22-23(27(20)34)26(33)19-6-4-3-5-18(19)25(22)32/h3-8,13-14,24,31,34H,9-12H2,1-2H3 |
| InChIKey | FHZJFKJUZSGYRT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|