C27H40O6 — CID 122190711
trimethyl (1S,4R,5R,9R,10R,12R,13R,14R)-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylate (PubChem CID 122190711) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is trimethyl (1S,4R,5R,9R,10R,12R,13R,14R)-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylate.
| Compound Name | trimethyl (1S,4R,5R,9R,10R,12R,13R,14R)-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylate |
|---|---|
| PubChem CID | 122190711 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | trimethyl (1S,4R,5R,9R,10R,12R,13R,14R)-5,9-dimethyl-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,13,14-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)OC)[C@@]23C=C(C(C)C)[C@@H]1C[C@@H]2[C@@]1(C)CCC[C@@](C)(C(=O)OC)[C@@H]1CC3 |
| InChI | InChI=1S/C27H40O6/c1-15(2)17-14-27-12-9-18-25(3,10-8-11-26(18,4)24(30)33-7)19(27)13-16(17)20(22(28)31-5)21(27)23(29)32-6/h14-16,18-21H,8-13H2,1-7H3/t16-,18+,19+,20+,21-,25-,26+,27-/m0/s1 |
| InChIKey | JPLRBUFIJJAJFM-BPNMLAGBSA-N |
| XLogP | 4.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|