C23H18Cl4N2O4 — CID 122190849
(7S,11R)-7,11-bis(2,6-dichlorophenyl)-2,4-dimethyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 122190849) has the molecular formula C23H18Cl4N2O4 and a molecular weight of 528.22 g/mol. Its IUPAC name is (7S,11R)-7,11-bis(2,6-dichlorophenyl)-2,4-dimethyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | (7S,11R)-7,11-bis(2,6-dichlorophenyl)-2,4-dimethyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 122190849 |
| Molecular Formula | C23H18Cl4N2O4 |
| Molecular Weight | 528.22 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | (7S,11R)-7,11-bis(2,6-dichlorophenyl)-2,4-dimethyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | CN1C(=O)N(C)C(=O)C2(C1=O)[C@@H](c1c(Cl)cccc1Cl)CC(=O)C[C@H]2c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H18Cl4N2O4/c1-28-20(31)23(21(32)29(2)22(28)33)12(18-14(24)5-3-6-15(18)25)9-11(30)10-13(23)19-16(26)7-4-8-17(19)27/h3-8,12-13H,9-10H2,1-2H3/t12-,13+ |
| InChIKey | MCIMHDZZHVWARR-BETUJISGSA-N |
| XLogP | 5.57 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.22 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|