C18H18N4O3S — CID 122190964
5-phenyl-N-[4-(1,3-thiazole-4-carbonylamino)butyl]-1,2-oxazole-3-carboxamide (PubChem CID 122190964) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 5-phenyl-N-[4-(1,3-thiazole-4-carbonylamino)butyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[4-(1,3-thiazole-4-carbonylamino)butyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122190964 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 5-phenyl-N-[4-(1,3-thiazole-4-carbonylamino)butyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCCNC(=O)c1cc(-c2ccccc2)on1)c1cscn1 |
| InChI | InChI=1S/C18H18N4O3S/c23-17(14-10-16(25-22-14)13-6-2-1-3-7-13)19-8-4-5-9-20-18(24)15-11-26-12-21-15/h1-3,6-7,10-12H,4-5,8-9H2,(H,19,23)(H,20,24) |
| InChIKey | HRUQGTHFIMOKFR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|