About N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide
N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 122190980) has the molecular formula C17H16N8O2
and a molecular weight of 364.37 g/mol. Its IUPAC name is N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 122190980 |
| Molecular Formula | C17H16N8O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccnc(NCCCNC(=O)c2cc(-c3ccccc3)on2)n1 |
| InChI | InChI=1S/C17H16N8O2/c18-25-23-15-7-10-21-17(22-15)20-9-4-8-19-16(26)13-11-14(27-24-13)12-5-2-1-3-6-12/h1-3,5-7,10-11H,4,8-9H2,(H,19,26)(H,20,21,22) |
| InChIKey | VJKDRJDZLLDGPF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide (CID 122190980) is N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide is [N-]=[N+]=Nc1ccnc(NCCCNC(=O)c2cc(-c3ccccc3)on2)n1.
What is the InChIKey of N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide?
The InChIKey is VJKDRJDZLLDGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N8O2/c18-25-23-15-7-10-21-17(22-15)20-9-4-8-19-16(26)13-11-14(27-24-13)12-5-2-1-3-6-12/h1-3,5-7,10-11H,4,8-9H2,(H,19,26)(H,20,21,22).
What are the key properties of N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide?
N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide has a molecular weight of 364.37 g/mol, XLogP of 3.31, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(4-azidopyrimidin-2-yl)amino]propyl]-5-phenyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 122190980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).