About N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide
N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide (PubChem CID 122191182) has the molecular formula C17H28N4O3
and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide |
| PubChem CID | 122191182 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide |
| SMILES | COc1nc(N2CCCCC2)nc(OC)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C17H28N4O3/c1-17(2,3)11-12(22)18-13-14(23-4)19-16(20-15(13)24-5)21-9-7-6-8-10-21/h6-11H2,1-5H3,(H,18,22) |
| InChIKey | OUJIRFWVPYPTHO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide?
The IUPAC name of N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide (CID 122191182) is N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide.
What is the SMILES notation for N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide?
The canonical SMILES for N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide is COc1nc(N2CCCCC2)nc(OC)c1NC(=O)CC(C)(C)C.
What is the InChIKey of N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide?
The InChIKey is OUJIRFWVPYPTHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O3/c1-17(2,3)11-12(22)18-13-14(23-4)19-16(20-15(13)24-5)21-9-7-6-8-10-21/h6-11H2,1-5H3,(H,18,22).
What are the key properties of N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide?
N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide has a molecular weight of 336.44 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethoxy-2-piperidin-1-ylpyrimidin-5-yl)-3,3-dimethylbutanamide is sourced from PubChem (CID 122191182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).