About N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine (PubChem CID 122191244) has the molecular formula C21H14FN5OS
and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine |
| PubChem CID | 122191244 |
| Molecular Formula | C21H14FN5OS |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccccc1-c1cc(CN(c2ncccn2)c2nc3ccccc3s2)on1 |
| InChI | InChI=1S/C21H14FN5OS/c22-16-7-2-1-6-15(16)18-12-14(28-26-18)13-27(20-23-10-5-11-24-20)21-25-17-8-3-4-9-19(17)29-21/h1-12H,13H2 |
| InChIKey | JSQHDRUYVPFOKT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 67.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine?
The IUPAC name of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine (CID 122191244) is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine is Fc1ccccc1-c1cc(CN(c2ncccn2)c2nc3ccccc3s2)on1.
What is the InChIKey of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine?
The InChIKey is JSQHDRUYVPFOKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14FN5OS/c22-16-7-2-1-6-15(16)18-12-14(28-26-18)13-27(20-23-10-5-11-24-20)21-25-17-8-3-4-9-19(17)29-21/h1-12H,13H2.
What are the key properties of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine?
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine has a molecular weight of 403.44 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-N-pyrimidin-2-yl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 122191244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).