C16H21NO5 — CID 122191255
(6R,7R,8R,8aR)-6,7,8-trihydroxy-8a-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 122191255) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is (6R,7R,8R,8aR)-6,7,8-trihydroxy-8a-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (6R,7R,8R,8aR)-6,7,8-trihydroxy-8a-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 122191255 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (6R,7R,8R,8aR)-6,7,8-trihydroxy-8a-(phenylmethoxymethyl)-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | O=C1CC[C@@]2(COCc3ccccc3)[C@@H](O)[C@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C16H21NO5/c18-12-8-17-13(19)6-7-16(17,15(21)14(12)20)10-22-9-11-4-2-1-3-5-11/h1-5,12,14-15,18,20-21H,6-10H2/t12-,14-,15+,16-/m1/s1 |
| InChIKey | WZFPQQJRQINDHL-DMRZNYOFSA-N |
| XLogP | -0.34 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |